C37H26O10 — CID 163601335
6-[10-[3-[2,3,4,5-tetrahydroxy-6-(hydroxymethyl)phenyl]naphthalen-1-yl]anthracen-9-yl]benzene-1,2,3,4,5-pentol (PubChem CID 163601335) has the molecular formula C37H26O10 and a molecular weight of 630.60 g/mol. Its IUPAC name is 6-[10-[3-[2,3,4,5-tetrahydroxy-6-(hydroxymethyl)phenyl]naphthalen-1-yl]anthracen-9-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[10-[3-[2,3,4,5-tetrahydroxy-6-(hydroxymethyl)phenyl]naphthalen-1-yl]anthracen-9-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 163601335 |
| Molecular Formula | C37H26O10 |
| Molecular Weight | 630.60 g/mol |
| Exact Mass | 630.15 |
| IUPAC Name | 6-[10-[3-[2,3,4,5-tetrahydroxy-6-(hydroxymethyl)phenyl]naphthalen-1-yl]anthracen-9-yl]benzene-1,2,3,4,5-pentol |
| SMILES | OCc1c(O)c(O)c(O)c(O)c1-c1cc(-c2c3ccccc3c(-c3c(O)c(O)c(O)c(O)c3O)c3ccccc23)c2ccccc2c1 |
| InChI | InChI=1S/C37H26O10/c38-15-24-25(30(40)34(44)33(43)29(24)39)17-13-16-7-1-2-8-18(16)23(14-17)26-19-9-3-5-11-21(19)27(22-12-6-4-10-20(22)26)28-31(41)35(45)37(47)36(46)32(28)42/h1-14,38-47H,15H2 |
| InChIKey | GXXGULZGFHBTQG-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 202.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.60 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|