C42H26O6 — CID 167074603
6-[10-(3-naphthalen-1-yldibenzofuran-1-yl)anthracen-9-yl]benzene-1,2,3,4,5-pentol (PubChem CID 167074603) has the molecular formula C42H26O6 and a molecular weight of 626.66 g/mol. Its IUPAC name is 6-[10-(3-naphthalen-1-yldibenzofuran-1-yl)anthracen-9-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[10-(3-naphthalen-1-yldibenzofuran-1-yl)anthracen-9-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 167074603 |
| Molecular Formula | C42H26O6 |
| Molecular Weight | 626.66 g/mol |
| Exact Mass | 626.17 |
| IUPAC Name | 6-[10-(3-naphthalen-1-yldibenzofuran-1-yl)anthracen-9-yl]benzene-1,2,3,4,5-pentol |
| SMILES | Oc1c(O)c(O)c(-c2c3ccccc3c(-c3cc(-c4cccc5ccccc45)cc4oc5ccccc5c34)c3ccccc23)c(O)c1O |
| InChI | InChI=1S/C42H26O6/c43-38-37(39(44)41(46)42(47)40(38)45)36-28-15-5-3-13-26(28)34(27-14-4-6-16-29(27)36)31-20-23(25-18-9-11-22-10-1-2-12-24(22)25)21-33-35(31)30-17-7-8-19-32(30)48-33/h1-21,43-47H |
| InChIKey | YKTOZFFAQDEMFR-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.66 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|