C38H24O6 — CID 162140725
6-[10-(3-phenyldibenzofuran-1-yl)anthracen-9-yl]benzene-1,2,3,4,5-pentol (PubChem CID 162140725) has the molecular formula C38H24O6 and a molecular weight of 576.60 g/mol. Its IUPAC name is 6-[10-(3-phenyldibenzofuran-1-yl)anthracen-9-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[10-(3-phenyldibenzofuran-1-yl)anthracen-9-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 162140725 |
| Molecular Formula | C38H24O6 |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | 6-[10-(3-phenyldibenzofuran-1-yl)anthracen-9-yl]benzene-1,2,3,4,5-pentol |
| SMILES | Oc1c(O)c(O)c(-c2c3ccccc3c(-c3cc(-c4ccccc4)cc4oc5ccccc5c34)c3ccccc23)c(O)c1O |
| InChI | InChI=1S/C38H24O6/c39-34-33(35(40)37(42)38(43)36(34)41)32-24-14-6-4-12-22(24)30(23-13-5-7-15-25(23)32)27-18-21(20-10-2-1-3-11-20)19-29-31(27)26-16-8-9-17-28(26)44-29/h1-19,39-43H |
| InChIKey | ZJWUOIGHKUERBT-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|