C48H30O6 — CID 163891273
6-[10-[5-(7-phenyldibenzofuran-1-yl)naphthalen-1-yl]anthracen-9-yl]benzene-1,2,3,4,5-pentol (PubChem CID 163891273) has the molecular formula C48H30O6 and a molecular weight of 702.76 g/mol. Its IUPAC name is 6-[10-[5-(7-phenyldibenzofuran-1-yl)naphthalen-1-yl]anthracen-9-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[10-[5-(7-phenyldibenzofuran-1-yl)naphthalen-1-yl]anthracen-9-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 163891273 |
| Molecular Formula | C48H30O6 |
| Molecular Weight | 702.76 g/mol |
| Exact Mass | 702.20 |
| IUPAC Name | 6-[10-[5-(7-phenyldibenzofuran-1-yl)naphthalen-1-yl]anthracen-9-yl]benzene-1,2,3,4,5-pentol |
| SMILES | Oc1c(O)c(O)c(-c2c3ccccc3c(-c3cccc4c(-c5cccc6oc7cc(-c8ccccc8)ccc7c56)cccc34)c3ccccc23)c(O)c1O |
| InChI | InChI=1S/C48H30O6/c49-44-43(45(50)47(52)48(53)46(44)51)42-35-15-6-4-13-33(35)40(34-14-5-7-16-36(34)42)31-20-9-17-28-29(31)18-8-19-30(28)32-21-10-22-38-41(32)37-24-23-27(25-39(37)54-38)26-11-2-1-3-12-26/h1-25,49-53H |
| InChIKey | QBSYPWKPNYQIRW-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.76 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|