C64H40O6 — CID 159454019
6-[10-[4-[2-(8,9-diphenyldibenzofuran-3-yl)phenanthren-9-yl]phenyl]anthracen-9-yl]benzene-1,2,3,4,5-pentol (PubChem CID 159454019) has the molecular formula C64H40O6 and a molecular weight of 905.02 g/mol. Its IUPAC name is 6-[10-[4-[2-(8,9-diphenyldibenzofuran-3-yl)phenanthren-9-yl]phenyl]anthracen-9-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[10-[4-[2-(8,9-diphenyldibenzofuran-3-yl)phenanthren-9-yl]phenyl]anthracen-9-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 159454019 |
| Molecular Formula | C64H40O6 |
| Molecular Weight | 905.02 g/mol |
| Exact Mass | 904.28 |
| IUPAC Name | 6-[10-[4-[2-(8,9-diphenyldibenzofuran-3-yl)phenanthren-9-yl]phenyl]anthracen-9-yl]benzene-1,2,3,4,5-pentol |
| SMILES | Oc1c(O)c(O)c(-c2c3ccccc3c(-c3ccc(-c4cc5cc(-c6ccc7c(c6)oc6ccc(-c8ccccc8)c(-c8ccccc8)c67)ccc5c5ccccc45)cc3)c3ccccc23)c(O)c1O |
| InChI | InChI=1S/C64H40O6/c65-60-59(61(66)63(68)64(69)62(60)67)57-49-21-11-9-19-47(49)55(48-20-10-12-22-50(48)57)39-25-23-37(24-26-39)52-34-42-33-40(27-29-43(42)45-17-7-8-18-46(45)52)41-28-30-51-54(35-41)70-53-32-31-44(36-13-3-1-4-14-36)56(58(51)53)38-15-5-2-6-16-38/h1-35,65-69H |
| InChIKey | LTSSQEGCPDNAGP-UHFFFAOYSA-N |
| XLogP | 16.73 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.02 |
| LogP ≤ 5 | 16.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|