C31H22O6 — CID 163532535
6-[10-(3-methoxynaphthalen-1-yl)anthracen-9-yl]benzene-1,2,3,4,5-pentol (PubChem CID 163532535) has the molecular formula C31H22O6 and a molecular weight of 490.51 g/mol. Its IUPAC name is 6-[10-(3-methoxynaphthalen-1-yl)anthracen-9-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[10-(3-methoxynaphthalen-1-yl)anthracen-9-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 163532535 |
| Molecular Formula | C31H22O6 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 6-[10-(3-methoxynaphthalen-1-yl)anthracen-9-yl]benzene-1,2,3,4,5-pentol |
| SMILES | COc1cc(-c2c3ccccc3c(-c3c(O)c(O)c(O)c(O)c3O)c3ccccc23)c2ccccc2c1 |
| InChI | InChI=1S/C31H22O6/c1-37-17-14-16-8-2-3-9-18(16)23(15-17)24-19-10-4-6-12-21(19)25(22-13-7-5-11-20(22)24)26-27(32)29(34)31(36)30(35)28(26)33/h2-15,32-36H,1H3 |
| InChIKey | DUFDQLVXOBLQQJ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|