C28H22O8 — CID 142377570
6-anthracen-9-yldibenzofuran-1,2,3,4,7,8,9-heptol;ethane (PubChem CID 142377570) has the molecular formula C28H22O8 and a molecular weight of 486.48 g/mol. Its IUPAC name is 6-anthracen-9-yldibenzofuran-1,2,3,4,7,8,9-heptol;ethane.
| Compound Name | 6-anthracen-9-yldibenzofuran-1,2,3,4,7,8,9-heptol;ethane |
|---|---|
| PubChem CID | 142377570 |
| Molecular Formula | C28H22O8 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 6-anthracen-9-yldibenzofuran-1,2,3,4,7,8,9-heptol;ethane |
| SMILES | CC.Oc1c(O)c(O)c2c(oc3c(-c4c5ccccc5cc5ccccc45)c(O)c(O)c(O)c32)c1O |
| InChI | InChI=1S/C26H16O8.C2H6/c27-18-15(14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14)25-16(19(28)21(18)30)17-20(29)22(31)23(32)24(33)26(17)34-25;1-2/h1-9,27-33H;1-2H3 |
| InChIKey | CJYJICNJAGMPNF-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 154.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|