C32H20O12 — CID 163698610
6-(2,3,6,7-tetrahydroxy-10-phenylanthracen-9-yl)dibenzofuran-1,2,3,4,7,8,9-heptol (PubChem CID 163698610) has the molecular formula C32H20O12 and a molecular weight of 596.50 g/mol. Its IUPAC name is 6-(2,3,6,7-tetrahydroxy-10-phenylanthracen-9-yl)dibenzofuran-1,2,3,4,7,8,9-heptol.
| Compound Name | 6-(2,3,6,7-tetrahydroxy-10-phenylanthracen-9-yl)dibenzofuran-1,2,3,4,7,8,9-heptol |
|---|---|
| PubChem CID | 163698610 |
| Molecular Formula | C32H20O12 |
| Molecular Weight | 596.50 g/mol |
| Exact Mass | 596.10 |
| IUPAC Name | 6-(2,3,6,7-tetrahydroxy-10-phenylanthracen-9-yl)dibenzofuran-1,2,3,4,7,8,9-heptol |
| SMILES | Oc1cc2c(-c3ccccc3)c3cc(O)c(O)cc3c(-c3c(O)c(O)c(O)c4c3oc3c(O)c(O)c(O)c(O)c34)c2cc1O |
| InChI | InChI=1S/C32H20O12/c33-15-6-11-13(8-17(15)35)20(14-9-18(36)16(34)7-12(14)19(11)10-4-2-1-3-5-10)21-24(37)27(40)25(38)22-23-26(39)28(41)29(42)30(43)32(23)44-31(21)22/h1-9,33-43H |
| InChIKey | JZALKBKTLNXYFB-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 235.67 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.50 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|