C34H22O18 — CID 163547290
6-[1,2,3,4-tetrahydroxy-10-(2,3,4,5,6-pentahydroxyphenyl)anthracen-9-yl]phenanthrene-1,2,3,4,5,7,8,9,10-nonol (PubChem CID 163547290) has the molecular formula C34H22O18 and a molecular weight of 718.53 g/mol. Its IUPAC name is 6-[1,2,3,4-tetrahydroxy-10-(2,3,4,5,6-pentahydroxyphenyl)anthracen-9-yl]phenanthrene-1,2,3,4,5,7,8,9,10-nonol.
| Compound Name | 6-[1,2,3,4-tetrahydroxy-10-(2,3,4,5,6-pentahydroxyphenyl)anthracen-9-yl]phenanthrene-1,2,3,4,5,7,8,9,10-nonol |
|---|---|
| PubChem CID | 163547290 |
| Molecular Formula | C34H22O18 |
| Molecular Weight | 718.53 g/mol |
| Exact Mass | 718.08 |
| IUPAC Name | 6-[1,2,3,4-tetrahydroxy-10-(2,3,4,5,6-pentahydroxyphenyl)anthracen-9-yl]phenanthrene-1,2,3,4,5,7,8,9,10-nonol |
| SMILES | Oc1c(O)c(O)c(-c2c3ccccc3c(-c3c(O)c(O)c4c(O)c(O)c5c(O)c(O)c(O)c(O)c5c4c3O)c3c(O)c(O)c(O)c(O)c23)c(O)c1O |
| InChI | InChI=1S/C34H22O18/c35-17-11-12-16(27(45)31(49)30(48)20(12)38)24(42)23(41)15(11)22(40)21(39)13(17)7-5-3-1-2-4-6(5)8(10-9(7)18(36)28(46)29(47)19(10)37)14-25(43)32(50)34(52)33(51)26(14)44/h1-4,35-52H |
| InChIKey | FGDLLBMMNAQOHM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 364.14 Ų |
| H-Bond Donors | 18 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 18 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|