C45H30O7 — CID 163725509
7-[4-[10-(1a,9b-dihydro-1H-cyclopropa[l]phenanthren-8-yl)anthracen-9-yl]phenyl]naphthalene-1,2,3,4,5,6,8-heptol (PubChem CID 163725509) has the molecular formula C45H30O7 and a molecular weight of 682.73 g/mol. Its IUPAC name is 7-[4-[10-(1a,9b-dihydro-1H-cyclopropa[l]phenanthren-8-yl)anthracen-9-yl]phenyl]naphthalene-1,2,3,4,5,6,8-heptol.
| Compound Name | 7-[4-[10-(1a,9b-dihydro-1H-cyclopropa[l]phenanthren-8-yl)anthracen-9-yl]phenyl]naphthalene-1,2,3,4,5,6,8-heptol |
|---|---|
| PubChem CID | 163725509 |
| Molecular Formula | C45H30O7 |
| Molecular Weight | 682.73 g/mol |
| Exact Mass | 682.20 |
| IUPAC Name | 7-[4-[10-(1a,9b-dihydro-1H-cyclopropa[l]phenanthren-8-yl)anthracen-9-yl]phenyl]naphthalene-1,2,3,4,5,6,8-heptol |
| SMILES | Oc1c(O)c(O)c2c(O)c(-c3ccc(-c4c5ccccc5c(-c5ccc6c(c5)C5CC5c5ccccc5-6)c5ccccc45)cc3)c(O)c(O)c2c1O |
| InChI | InChI=1S/C45H30O7/c46-39-36(40(47)41(48)38-37(39)42(49)44(51)45(52)43(38)50)22-15-13-21(14-16-22)34-27-9-3-5-11-29(27)35(30-12-6-4-10-28(30)34)23-17-18-26-24-7-1-2-8-25(24)32-20-33(32)31(26)19-23/h1-19,32-33,46-52H,20H2 |
| InChIKey | KVFJMAZUWKVCLM-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.73 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|