C38H22O8 — CID 170244051
7-(6-dibenzofuran-1-ylpyren-1-yl)naphthalene-1,2,3,4,5,6,8-heptol (PubChem CID 170244051) has the molecular formula C38H22O8 and a molecular weight of 606.59 g/mol. Its IUPAC name is 7-(6-dibenzofuran-1-ylpyren-1-yl)naphthalene-1,2,3,4,5,6,8-heptol.
| Compound Name | 7-(6-dibenzofuran-1-ylpyren-1-yl)naphthalene-1,2,3,4,5,6,8-heptol |
|---|---|
| PubChem CID | 170244051 |
| Molecular Formula | C38H22O8 |
| Molecular Weight | 606.59 g/mol |
| Exact Mass | 606.13 |
| IUPAC Name | 7-(6-dibenzofuran-1-ylpyren-1-yl)naphthalene-1,2,3,4,5,6,8-heptol |
| SMILES | Oc1c(O)c(O)c2c(O)c(-c3ccc4ccc5c(-c6cccc7oc8ccccc8c67)ccc6ccc3c4c65)c(O)c(O)c2c1O |
| InChI | InChI=1S/C38H22O8/c39-32-29(33(40)34(41)31-30(32)35(42)37(44)38(45)36(31)43)22-15-11-17-9-13-20-18(12-8-16-10-14-21(22)27(17)26(16)20)19-5-3-7-25-28(19)23-4-1-2-6-24(23)46-25/h1-15,39-45H |
| InChIKey | MZPYGIWRWVJPRC-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 154.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.59 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|