C44H26O11 — CID 163496092
8-[4-(8-dibenzofuran-4-ylpyren-1-yl)-2,3,5,6-tetrahydroxyphenyl]naphthalene-1,2,3,4,5,6-hexol (PubChem CID 163496092) has the molecular formula C44H26O11 and a molecular weight of 730.68 g/mol. Its IUPAC name is 8-[4-(8-dibenzofuran-4-ylpyren-1-yl)-2,3,5,6-tetrahydroxyphenyl]naphthalene-1,2,3,4,5,6-hexol.
| Compound Name | 8-[4-(8-dibenzofuran-4-ylpyren-1-yl)-2,3,5,6-tetrahydroxyphenyl]naphthalene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 163496092 |
| Molecular Formula | C44H26O11 |
| Molecular Weight | 730.68 g/mol |
| Exact Mass | 730.15 |
| IUPAC Name | 8-[4-(8-dibenzofuran-4-ylpyren-1-yl)-2,3,5,6-tetrahydroxyphenyl]naphthalene-1,2,3,4,5,6-hexol |
| SMILES | Oc1cc(-c2c(O)c(O)c(-c3ccc4ccc5ccc(-c6cccc7c6oc6ccccc67)c6ccc3c4c56)c(O)c2O)c2c(O)c(O)c(O)c(O)c2c1O |
| InChI | InChI=1S/C44H26O11/c45-27-16-26(31-34(35(27)46)41(52)43(54)42(53)36(31)47)33-39(50)37(48)32(38(49)40(33)51)23-13-11-18-9-8-17-10-12-19(21-14-15-22(23)30(18)29(17)21)24-5-3-6-25-20-4-1-2-7-28(20)55-44(24)25/h1-16,45-54H |
| InChIKey | NSQGXAKZMBXEMR-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 215.44 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.68 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|