C40H26O26 — CID 158377859
9-(2,3,4,5,6,7,8-heptahydroxynaphthalen-1-yl)-10-[2-(1,3,4,5,6,7,8-heptahydroxynaphthalen-2-yl)-3,4,5,6-tetrahydroxyphenyl]anthracene-1,2,3,4,5,6,7,8-octol (PubChem CID 158377859) has the molecular formula C40H26O26 and a molecular weight of 922.62 g/mol. Its IUPAC name is 9-(2,3,4,5,6,7,8-heptahydroxynaphthalen-1-yl)-10-[2-(1,3,4,5,6,7,8-heptahydroxynaphthalen-2-yl)-3,4,5,6-tetrahydroxyphenyl]anthracene-1,2,3,4,5,6,7,8-octol.
| Compound Name | 9-(2,3,4,5,6,7,8-heptahydroxynaphthalen-1-yl)-10-[2-(1,3,4,5,6,7,8-heptahydroxynaphthalen-2-yl)-3,4,5,6-tetrahydroxyphenyl]anthracene-1,2,3,4,5,6,7,8-octol |
|---|---|
| PubChem CID | 158377859 |
| Molecular Formula | C40H26O26 |
| Molecular Weight | 922.62 g/mol |
| Exact Mass | 922.07 |
| IUPAC Name | 9-(2,3,4,5,6,7,8-heptahydroxynaphthalen-1-yl)-10-[2-(1,3,4,5,6,7,8-heptahydroxynaphthalen-2-yl)-3,4,5,6-tetrahydroxyphenyl]anthracene-1,2,3,4,5,6,7,8-octol |
| SMILES | Oc1c(O)c(O)c(-c2c3c(O)c(O)c(O)c(O)c3c(-c3c(O)c(O)c(O)c4c(O)c(O)c(O)c(O)c34)c3c(O)c(O)c(O)c(O)c23)c(-c2c(O)c(O)c3c(O)c(O)c(O)c(O)c3c2O)c1O |
| InChI | InChI=1S/C40H26O26/c41-15-11(24(50)25(51)14-13(15)28(54)39(65)40(66)29(14)55)9-7(21(47)35(61)36(62)22(9)48)1-3-5(19(45)33(59)31(57)17(3)43)2(6-4(1)18(44)32(58)34(60)20(6)46)8-10-12(26(52)30(56)16(8)42)27(53)38(64)37(63)23(10)49/h41-66H |
| InChIKey | GVKOVKYSRFXKHB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 525.98 Ų |
| H-Bond Donors | 26 |
| H-Bond Acceptors | 26 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.62 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 26 |
| H-Bond Acceptors ≤ 10 | 26 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|