C20H14O14 — CID 163964140
10-(2,3,4,5,6-pentahydroxyphenyl)anthracene-1,2,3,4,5,6,7,8,9-nonol (PubChem CID 163964140) has the molecular formula C20H14O14 and a molecular weight of 478.32 g/mol. Its IUPAC name is 10-(2,3,4,5,6-pentahydroxyphenyl)anthracene-1,2,3,4,5,6,7,8,9-nonol.
| Compound Name | 10-(2,3,4,5,6-pentahydroxyphenyl)anthracene-1,2,3,4,5,6,7,8,9-nonol |
|---|---|
| PubChem CID | 163964140 |
| Molecular Formula | C20H14O14 |
| Molecular Weight | 478.32 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | 10-(2,3,4,5,6-pentahydroxyphenyl)anthracene-1,2,3,4,5,6,7,8,9-nonol |
| SMILES | Oc1c(O)c(O)c(-c2c3c(O)c(O)c(O)c(O)c3c(O)c3c(O)c(O)c(O)c(O)c23)c(O)c1O |
| InChI | InChI=1S/C20H14O14/c21-7-5-2(8(22)14(28)16(30)12(5)26)1(3-6(7)13(27)17(31)15(29)9(3)23)4-10(24)18(32)20(34)19(33)11(4)25/h21-34H |
| InChIKey | SKDWSKBTWZOVBN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 283.22 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|