C42H24BO14 — CID 174140034
CID 174140034 (PubChem CID 174140034) has the molecular formula C42H24BO14 and a molecular weight of 763.45 g/mol.
| Compound Name | CID 174140034 |
|---|---|
| PubChem CID | 174140034 |
| Molecular Formula | C42H24BO14 |
| Molecular Weight | 763.45 g/mol |
| Exact Mass | 763.13 |
| IUPAC Name | — |
| SMILES | Oc1c(O)c(O)c(-c2c3ccccc3c(-c3ccc4oc5c6c(O)c(O)c(O)c7c6c(c(O)c5c4c3)-c3c(O)c(O)c(O)c(O)c3[B]7)c3ccccc23)c(O)c1O |
| InChI | InChI=1S/C42H24BO14/c44-29-21-17-11-12(19-13-5-1-3-7-15(13)20(16-8-4-2-6-14(16)19)25-31(46)38(53)41(56)39(54)32(25)47)9-10-18(17)57-42(21)26-22-23(29)24-28(35(50)40(55)37(52)30(24)45)43-27(22)34(49)36(51)33(26)48/h1-11,44-56H |
| InChIKey | CYHFZSDOIUNEFD-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 276.13 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 57 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.45 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|