C44H31BO9 — CID 174139082
CID 174139082 (PubChem CID 174139082) has the molecular formula C44H31BO9 and a molecular weight of 714.54 g/mol.
| Compound Name | CID 174139082 |
|---|---|
| PubChem CID | 174139082 |
| Molecular Formula | C44H31BO9 |
| Molecular Weight | 714.54 g/mol |
| Exact Mass | 714.21 |
| IUPAC Name | — |
| SMILES | [B]c1c(O)c(O)c(O)c(O)c1-c1ccc(-c2c3c(c(-c4ccc5oc6c7c(O)c(C)c(C)c(O)c7c(O)c(O)c6c5c4)c4ccccc24)C=CCC3)cc1 |
| InChI | InChI=1S/C44H31BO9/c1-18-19(2)37(47)34-33(36(18)46)40(50)39(49)32-27-17-22(15-16-28(27)54-44(32)34)30-25-9-5-3-7-23(25)29(24-8-4-6-10-26(24)30)20-11-13-21(14-12-20)31-35(45)41(51)43(53)42(52)38(31)48/h3,5-7,9-17,46-53H,4,8H2,1-2H3 |
| InChIKey | ZLUOMHQYKKFPFH-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 174.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.54 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|