C54H34B2O4 — CID 174011841
CID 174011841 (PubChem CID 174011841) has the molecular formula C54H34B2O4 and a molecular weight of 768.49 g/mol.
| Compound Name | CID 174011841 |
|---|---|
| PubChem CID | 174011841 |
| Molecular Formula | C54H34B2O4 |
| Molecular Weight | 768.49 g/mol |
| Exact Mass | 768.26 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c(-c2c3ccccc3c(-c3cccc4oc5ccc(-c6ccc(C7=C(c8ccc9ccccc9c8)C=CCC7)cc6)cc5c34)c3ccccc23)c(O)c(O)c1O |
| InChI | InChI=1S/C54H34B2O4/c55-50-49(52(57)54(59)53(58)51(50)56)48-40-16-7-5-14-38(40)46(39-15-6-8-17-41(39)48)42-18-9-19-45-47(42)43-29-34(26-27-44(43)60-45)31-20-23-32(24-21-31)36-12-3-4-13-37(36)35-25-22-30-10-1-2-11-33(30)28-35/h1-2,4-11,13-29,57-59H,3,12H2 |
| InChIKey | DEGDOQQNDGGERC-UHFFFAOYSA-N |
| XLogP | 12.01 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.49 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|