C22H20 — CID 143123986
10-methyl-9-(4-methylphenyl)-1,2-dihydroanthracene (PubChem CID 143123986) has the molecular formula C22H20 and a molecular weight of 284.40 g/mol. Its IUPAC name is 10-methyl-9-(4-methylphenyl)-1,2-dihydroanthracene.
| Compound Name | 10-methyl-9-(4-methylphenyl)-1,2-dihydroanthracene |
|---|---|
| PubChem CID | 143123986 |
| Molecular Formula | C22H20 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 10-methyl-9-(4-methylphenyl)-1,2-dihydroanthracene |
| SMILES | Cc1ccc(-c2c3c(c(C)c4ccccc24)C=CCC3)cc1 |
| InChI | InChI=1S/C22H20/c1-15-11-13-17(14-12-15)22-20-9-5-3-7-18(20)16(2)19-8-4-6-10-21(19)22/h3-5,7-9,11-14H,6,10H2,1-2H3 |
| InChIKey | WXJYZMKOSBGJNY-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |