C35H31P — CID 166895339
dimethyl-methylidene-[4-[10-(4-phenylphenyl)-3,4-dihydroanthracen-9-yl]phenyl]-λ5-phosphane (PubChem CID 166895339) has the molecular formula C35H31P and a molecular weight of 482.61 g/mol. Its IUPAC name is dimethyl-methylidene-[4-[10-(4-phenylphenyl)-3,4-dihydroanthracen-9-yl]phenyl]-λ5-phosphane.
| Compound Name | dimethyl-methylidene-[4-[10-(4-phenylphenyl)-3,4-dihydroanthracen-9-yl]phenyl]-λ5-phosphane |
|---|---|
| PubChem CID | 166895339 |
| Molecular Formula | C35H31P |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | dimethyl-methylidene-[4-[10-(4-phenylphenyl)-3,4-dihydroanthracen-9-yl]phenyl]-λ5-phosphane |
| SMILES | C=P(C)(C)c1ccc(-c2c3c(c(-c4ccc(-c5ccccc5)cc4)c4ccccc24)CCC=C3)cc1 |
| InChI | InChI=1S/C35H31P/c1-36(2,3)29-23-21-28(22-24-29)35-32-15-9-7-13-30(32)34(31-14-8-10-16-33(31)35)27-19-17-26(18-20-27)25-11-5-4-6-12-25/h4-7,9-13,15-24H,1,8,14H2,2-3H3 |
| InChIKey | VTMXSCKCCLOFJU-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|