C48H30O15 — CID 170281254
6-[8-[10-[2,3,4,5-tetrahydroxy-6-(2,3,4,5,6-pentahydroxyphenyl)phenyl]anthracen-9-yl]naphtho[1,2-b][1]benzofuran-5-yl]benzene-1,2,3,4,5-pentol (PubChem CID 170281254) has the molecular formula C48H30O15 and a molecular weight of 846.75 g/mol. Its IUPAC name is 6-[8-[10-[2,3,4,5-tetrahydroxy-6-(2,3,4,5,6-pentahydroxyphenyl)phenyl]anthracen-9-yl]naphtho[1,2-b][1]benzofuran-5-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[8-[10-[2,3,4,5-tetrahydroxy-6-(2,3,4,5,6-pentahydroxyphenyl)phenyl]anthracen-9-yl]naphtho[1,2-b][1]benzofuran-5-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 170281254 |
| Molecular Formula | C48H30O15 |
| Molecular Weight | 846.75 g/mol |
| Exact Mass | 846.16 |
| IUPAC Name | 6-[8-[10-[2,3,4,5-tetrahydroxy-6-(2,3,4,5,6-pentahydroxyphenyl)phenyl]anthracen-9-yl]naphtho[1,2-b][1]benzofuran-5-yl]benzene-1,2,3,4,5-pentol |
| SMILES | Oc1c(O)c(O)c(-c2c(O)c(O)c(O)c(O)c2-c2c3ccccc3c(-c3ccc4oc5c6ccccc6c(-c6c(O)c(O)c(O)c(O)c6O)cc5c4c3)c3ccccc23)c(O)c1O |
| InChI | InChI=1S/C48H30O15/c49-34-30(35(50)41(56)46(61)40(34)55)25-16-26-24-15-17(13-14-27(24)63-48(26)23-12-6-1-7-18(23)25)28-19-8-2-4-10-21(19)29(22-11-5-3-9-20(22)28)31-32(37(52)43(58)42(57)36(31)51)33-38(53)44(59)47(62)45(60)39(33)54/h1-16,49-62H |
| InChIKey | SEGPZFXCGGUZHU-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 296.36 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 63 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.75 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|