C45H28N4O7 — CID 174169203
8-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-(4-phenylcarbazol-9-yl)dibenzofuran-1,2,4,6,7,9-hexol (PubChem CID 174169203) has the molecular formula C45H28N4O7 and a molecular weight of 736.74 g/mol. Its IUPAC name is 8-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-(4-phenylcarbazol-9-yl)dibenzofuran-1,2,4,6,7,9-hexol.
| Compound Name | 8-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-(4-phenylcarbazol-9-yl)dibenzofuran-1,2,4,6,7,9-hexol |
|---|---|
| PubChem CID | 174169203 |
| Molecular Formula | C45H28N4O7 |
| Molecular Weight | 736.74 g/mol |
| Exact Mass | 736.20 |
| IUPAC Name | 8-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-(4-phenylcarbazol-9-yl)dibenzofuran-1,2,4,6,7,9-hexol |
| SMILES | Oc1c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(O)c2c(oc3c(O)c(-n4c5ccccc5c5c(-c6ccccc6)cccc54)c(O)c(O)c32)c1O |
| InChI | InChI=1S/C45H28N4O7/c50-35-31-32-36(51)38(53)34(49-28-21-11-10-19-27(28)30-26(20-12-22-29(30)49)23-13-4-1-5-14-23)39(54)41(32)56-42(31)40(55)37(52)33(35)45-47-43(24-15-6-2-7-16-24)46-44(48-45)25-17-8-3-9-18-25/h1-22,50-55H |
| InChIKey | BPABBFGDCHGJBF-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 178.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.74 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|