C51H31N5O6S — CID 174170439
3-(4-carbazol-9-ylcarbazol-9-yl)-7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophene-1,2,4,6,8,9-hexol (PubChem CID 174170439) has the molecular formula C51H31N5O6S and a molecular weight of 841.91 g/mol. Its IUPAC name is 3-(4-carbazol-9-ylcarbazol-9-yl)-7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophene-1,2,4,6,8,9-hexol.
| Compound Name | 3-(4-carbazol-9-ylcarbazol-9-yl)-7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophene-1,2,4,6,8,9-hexol |
|---|---|
| PubChem CID | 174170439 |
| Molecular Formula | C51H31N5O6S |
| Molecular Weight | 841.91 g/mol |
| Exact Mass | 841.20 |
| IUPAC Name | 3-(4-carbazol-9-ylcarbazol-9-yl)-7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophene-1,2,4,6,8,9-hexol |
| SMILES | Oc1c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(O)c2sc3c(O)c(-n4c5ccccc5c5c(-n6c7ccccc7c7ccccc76)cccc54)c(O)c(O)c3c2c1O |
| InChI | InChI=1S/C51H31N5O6S/c57-41-37-38-42(58)45(61)40(56-33-23-12-9-20-30(33)36-34(24-13-25-35(36)56)55-31-21-10-7-18-28(31)29-19-8-11-22-32(29)55)46(62)48(38)63-47(37)44(60)39(43(41)59)51-53-49(26-14-3-1-4-15-26)52-50(54-51)27-16-5-2-6-17-27/h1-25,57-62H |
| InChIKey | USBWYJMDGBYIFQ-UHFFFAOYSA-N |
| XLogP | 11.67 |
| TPSA | 169.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.91 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|