About 2-hydroxy-3a,4-dihydroisoindole-1,3-dione
2-hydroxy-3a,4-dihydroisoindole-1,3-dione (PubChem CID 23442463) has the molecular formula C8H7NO3
and a molecular weight of 165.15 g/mol. Its IUPAC name is 2-hydroxy-3a,4-dihydroisoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-hydroxy-3a,4-dihydroisoindole-1,3-dione |
| PubChem CID | 23442463 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 2-hydroxy-3a,4-dihydroisoindole-1,3-dione |
| SMILES | O=C1C2=CC=CCC2C(=O)N1O |
| InChI | InChI=1S/C8H7NO3/c10-7-5-3-1-2-4-6(5)8(11)9(7)12/h1-3,6,12H,4H2 |
| InChIKey | GFAUUDVMIZFXDG-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3a,4-dihydroisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3a,4-dihydroisoindole-1,3-dione?
The IUPAC name of 2-hydroxy-3a,4-dihydroisoindole-1,3-dione (CID 23442463) is 2-hydroxy-3a,4-dihydroisoindole-1,3-dione.
What is the SMILES notation for 2-hydroxy-3a,4-dihydroisoindole-1,3-dione?
The canonical SMILES for 2-hydroxy-3a,4-dihydroisoindole-1,3-dione is O=C1C2=CC=CCC2C(=O)N1O.
What is the InChIKey of 2-hydroxy-3a,4-dihydroisoindole-1,3-dione?
The InChIKey is GFAUUDVMIZFXDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3/c10-7-5-3-1-2-4-6(5)8(11)9(7)12/h1-3,6,12H,4H2.
What are the key properties of 2-hydroxy-3a,4-dihydroisoindole-1,3-dione?
2-hydroxy-3a,4-dihydroisoindole-1,3-dione has a molecular weight of 165.15 g/mol, XLogP of 0.25, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3a,4-dihydroisoindole-1,3-dione is sourced from PubChem (CID 23442463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).