C9H10O — CID 141013179
2,3,7,7a-tetrahydroinden-1-one (PubChem CID 141013179) has the molecular formula C9H10O and a molecular weight of 134.18 g/mol. Its IUPAC name is 2,3,7,7a-tetrahydroinden-1-one.
| Compound Name | 2,3,7,7a-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 141013179 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 2,3,7,7a-tetrahydroinden-1-one |
| SMILES | O=C1CCC2=CC=CCC12 |
| InChI | InChI=1S/C9H10O/c10-9-6-5-7-3-1-2-4-8(7)9/h1-3,8H,4-6H2 |
| InChIKey | ASEAWLPXRSHGMD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |