C15H12O3 — CID 67065449
2-phenyl-4a,5-dihydrochromene-3,4-dione (PubChem CID 67065449) has the molecular formula C15H12O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-phenyl-4a,5-dihydrochromene-3,4-dione.
| Compound Name | 2-phenyl-4a,5-dihydrochromene-3,4-dione |
|---|---|
| PubChem CID | 67065449 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2-phenyl-4a,5-dihydrochromene-3,4-dione |
| SMILES | O=C1C(=O)C(c2ccccc2)OC2=CC=CCC12 |
| InChI | InChI=1S/C15H12O3/c16-13-11-8-4-5-9-12(11)18-15(14(13)17)10-6-2-1-3-7-10/h1-7,9,11,15H,8H2 |
| InChIKey | BQMNIVDBWOJYRF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|