C15H16O — CID 146679888
3-methyl-2-phenyl-2,3,3a,4-tetrahydro-1-benzofuran (PubChem CID 146679888) has the molecular formula C15H16O and a molecular weight of 212.29 g/mol. Its IUPAC name is 3-methyl-2-phenyl-2,3,3a,4-tetrahydro-1-benzofuran.
| Compound Name | 3-methyl-2-phenyl-2,3,3a,4-tetrahydro-1-benzofuran |
|---|---|
| PubChem CID | 146679888 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 3-methyl-2-phenyl-2,3,3a,4-tetrahydro-1-benzofuran |
| SMILES | CC1C2CC=CC=C2OC1c1ccccc1 |
| InChI | InChI=1S/C15H16O/c1-11-13-9-5-6-10-14(13)16-15(11)12-7-3-2-4-8-12/h2-8,10-11,13,15H,9H2,1H3 |
| InChIKey | VSYWFBPMUFRMFC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |