C15H14O4 — CID 174742399
4,5-dihydroxy-2-phenyl-4a,5-dihydro-4H-chromen-3-one (PubChem CID 174742399) has the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. Its IUPAC name is 4,5-dihydroxy-2-phenyl-4a,5-dihydro-4H-chromen-3-one.
| Compound Name | 4,5-dihydroxy-2-phenyl-4a,5-dihydro-4H-chromen-3-one |
|---|---|
| PubChem CID | 174742399 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 4,5-dihydroxy-2-phenyl-4a,5-dihydro-4H-chromen-3-one |
| SMILES | O=C1C(c2ccccc2)OC2=CC=CC(O)C2C1O |
| InChI | InChI=1S/C15H14O4/c16-10-7-4-8-11-12(10)13(17)14(18)15(19-11)9-5-2-1-3-6-9/h1-8,10,12-13,15-17H |
| InChIKey | RLFQILXELAGOOC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |