C21H24O8 — CID 142724544
(4R,7Z,9R,10S,13Z,15R,16S)-9,15-dihydroxy-10,16-dimethyl-4-phenyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione (PubChem CID 142724544) has the molecular formula C21H24O8 and a molecular weight of 404.42 g/mol. Its IUPAC name is (4R,7Z,9R,10S,13Z,15R,16S)-9,15-dihydroxy-10,16-dimethyl-4-phenyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione.
| Compound Name | (4R,7Z,9R,10S,13Z,15R,16S)-9,15-dihydroxy-10,16-dimethyl-4-phenyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione |
|---|---|
| PubChem CID | 142724544 |
| Molecular Formula | C21H24O8 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (4R,7Z,9R,10S,13Z,15R,16S)-9,15-dihydroxy-10,16-dimethyl-4-phenyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione |
| SMILES | C[C@@H]1OC(=O)/C=C\[C@@H](O)[C@H](C)OC(=O)C[C@H](c2ccccc2)OC(=O)/C=C\[C@H]1O |
| InChI | InChI=1S/C21H24O8/c1-13-16(22)9-11-20(25)29-18(15-6-4-3-5-7-15)12-21(26)28-14(2)17(23)8-10-19(24)27-13/h3-11,13-14,16-18,22-23H,12H2,1-2H3/b10-8-,11-9-/t13-,14-,16+,17+,18+/m0/s1 |
| InChIKey | VHIXBXWBELIWPZ-PJUIRXOOSA-N |
| XLogP | 1.37 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|