C16H19F3O8 — CID 177385257
(4S,7E,9R,13E,15R,16S)-9,15-dihydroxy-4,16-dimethyl-10-(trifluoromethyl)-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione (PubChem CID 177385257) has the molecular formula C16H19F3O8 and a molecular weight of 396.31 g/mol. Its IUPAC name is (4S,7E,9R,13E,15R,16S)-9,15-dihydroxy-4,16-dimethyl-10-(trifluoromethyl)-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione.
| Compound Name | (4S,7E,9R,13E,15R,16S)-9,15-dihydroxy-4,16-dimethyl-10-(trifluoromethyl)-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione |
|---|---|
| PubChem CID | 177385257 |
| Molecular Formula | C16H19F3O8 |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | (4S,7E,9R,13E,15R,16S)-9,15-dihydroxy-4,16-dimethyl-10-(trifluoromethyl)-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione |
| SMILES | C[C@@H]1OC(=O)C[C@H](C)OC(=O)/C=C/[C@@H](O)C(C(F)(F)F)OC(=O)/C=C/[C@H]1O |
| InChI | InChI=1S/C16H19F3O8/c1-8-7-14(24)26-9(2)10(20)3-5-13(23)27-15(16(17,18)19)11(21)4-6-12(22)25-8/h3-6,8-11,15,20-21H,7H2,1-2H3/b5-3+,6-4+/t8-,9-,10+,11+,15?/m0/s1 |
| InChIKey | KVVYPBNHRPOYIO-OVTWYPIGSA-N |
| XLogP | 0.56 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|