C18H24O8 — CID 91484889
9-hydroxy-10,16-dimethyl-4-(2-oxopropyl)-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione (PubChem CID 91484889) has the molecular formula C18H24O8 and a molecular weight of 368.38 g/mol. Its IUPAC name is 9-hydroxy-10,16-dimethyl-4-(2-oxopropyl)-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione.
| Compound Name | 9-hydroxy-10,16-dimethyl-4-(2-oxopropyl)-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione |
|---|---|
| PubChem CID | 91484889 |
| Molecular Formula | C18H24O8 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 9-hydroxy-10,16-dimethyl-4-(2-oxopropyl)-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione |
| SMILES | CC(=O)CC1CC(=O)OC(C)CC=CC(=O)OC(C)C(O)C=CC(=O)O1 |
| InChI | InChI=1S/C18H24O8/c1-11(19)9-14-10-18(23)24-12(2)5-4-6-16(21)25-13(3)15(20)7-8-17(22)26-14/h4,6-8,12-15,20H,5,9-10H2,1-3H3 |
| InChIKey | JKIRIKWJZGUFNH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|