C23H31NO7 — CID 177449743
(7E,9R,10S,15R,16S)-11-benzyl-9,15-dihydroxy-4,10,16-trimethyl-1,5-dioxa-11-azacyclohexadec-7-ene-2,6,12-trione (PubChem CID 177449743) has the molecular formula C23H31NO7 and a molecular weight of 433.50 g/mol. Its IUPAC name is (7E,9R,10S,15R,16S)-11-benzyl-9,15-dihydroxy-4,10,16-trimethyl-1,5-dioxa-11-azacyclohexadec-7-ene-2,6,12-trione.
| Compound Name | (7E,9R,10S,15R,16S)-11-benzyl-9,15-dihydroxy-4,10,16-trimethyl-1,5-dioxa-11-azacyclohexadec-7-ene-2,6,12-trione |
|---|---|
| PubChem CID | 177449743 |
| Molecular Formula | C23H31NO7 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | (7E,9R,10S,15R,16S)-11-benzyl-9,15-dihydroxy-4,10,16-trimethyl-1,5-dioxa-11-azacyclohexadec-7-ene-2,6,12-trione |
| SMILES | CC1CC(=O)O[C@@H](C)[C@H](O)CCC(=O)N(Cc2ccccc2)[C@@H](C)[C@H](O)/C=C/C(=O)O1 |
| InChI | InChI=1S/C23H31NO7/c1-15-13-23(29)31-17(3)20(26)9-11-21(27)24(14-18-7-5-4-6-8-18)16(2)19(25)10-12-22(28)30-15/h4-8,10,12,15-17,19-20,25-26H,9,11,13-14H2,1-3H3/b12-10+/t15?,16-,17-,19+,20+/m0/s1 |
| InChIKey | FIKAQSXDFVLPIB-RRTBEFJSSA-N |
| XLogP | 1.73 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |