C19H23NO5 — CID 165368403
(5E)-N-benzyl-5-hydroxy-N-methyl-5-[(6R)-6-methyl-2,4-dioxooxan-3-ylidene]pentanamide (PubChem CID 165368403) has the molecular formula C19H23NO5 and a molecular weight of 345.39 g/mol. Its IUPAC name is (5E)-N-benzyl-5-hydroxy-N-methyl-5-[(6R)-6-methyl-2,4-dioxooxan-3-ylidene]pentanamide.
| Compound Name | (5E)-N-benzyl-5-hydroxy-N-methyl-5-[(6R)-6-methyl-2,4-dioxooxan-3-ylidene]pentanamide |
|---|---|
| PubChem CID | 165368403 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (5E)-N-benzyl-5-hydroxy-N-methyl-5-[(6R)-6-methyl-2,4-dioxooxan-3-ylidene]pentanamide |
| SMILES | C[C@@H]1CC(=O)/C(=C(\O)CCCC(=O)N(C)Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C19H23NO5/c1-13-11-16(22)18(19(24)25-13)15(21)9-6-10-17(23)20(2)12-14-7-4-3-5-8-14/h3-5,7-8,13,21H,6,9-12H2,1-2H3/b18-15+/t13-/m1/s1 |
| InChIKey | JDOLDNIUSGLDAO-MIKWNVPKSA-N |
| XLogP | 2.53 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|