C21H27NO5 — CID 25171484
ethyl 1-benzyl-4-(1-ethoxy-1-oxobutan-2-yl)-6-oxo-2,3-dihydropyridine-5-carboxylate (PubChem CID 25171484) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is ethyl 1-benzyl-4-(1-ethoxy-1-oxobutan-2-yl)-6-oxo-2,3-dihydropyridine-5-carboxylate.
| Compound Name | ethyl 1-benzyl-4-(1-ethoxy-1-oxobutan-2-yl)-6-oxo-2,3-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 25171484 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | ethyl 1-benzyl-4-(1-ethoxy-1-oxobutan-2-yl)-6-oxo-2,3-dihydropyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C(CC)C(=O)OCC)CCN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C21H27NO5/c1-4-16(20(24)26-5-2)17-12-13-22(14-15-10-8-7-9-11-15)19(23)18(17)21(25)27-6-3/h7-11,16H,4-6,12-14H2,1-3H3 |
| InChIKey | FAFDXJFNDXETGL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|