C20H23NO5 — CID 102581724
diethyl 2-[2-[benzyl(buta-2,3-dienyl)amino]-2-oxoethylidene]propanedioate (PubChem CID 102581724) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is diethyl 2-[2-[benzyl(buta-2,3-dienyl)amino]-2-oxoethylidene]propanedioate.
| Compound Name | diethyl 2-[2-[benzyl(buta-2,3-dienyl)amino]-2-oxoethylidene]propanedioate |
|---|---|
| PubChem CID | 102581724 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | diethyl 2-[2-[benzyl(buta-2,3-dienyl)amino]-2-oxoethylidene]propanedioate |
| SMILES | C=C=CCN(Cc1ccccc1)C(=O)C=C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C20H23NO5/c1-4-7-13-21(15-16-11-9-8-10-12-16)18(22)14-17(19(23)25-5-2)20(24)26-6-3/h7-12,14H,1,5-6,13,15H2,2-3H3 |
| InChIKey | NGXPHHJNWZXUGO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|