C22H27NO7 — CID 23628364
diethyl 2-(1-benzyl-5-ethoxycarbonyl-6-oxo-2,3-dihydropyridin-4-yl)propanedioate (PubChem CID 23628364) has the molecular formula C22H27NO7 and a molecular weight of 417.46 g/mol. Its IUPAC name is diethyl 2-(1-benzyl-5-ethoxycarbonyl-6-oxo-2,3-dihydropyridin-4-yl)propanedioate.
| Compound Name | diethyl 2-(1-benzyl-5-ethoxycarbonyl-6-oxo-2,3-dihydropyridin-4-yl)propanedioate |
|---|---|
| PubChem CID | 23628364 |
| Molecular Formula | C22H27NO7 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | diethyl 2-(1-benzyl-5-ethoxycarbonyl-6-oxo-2,3-dihydropyridin-4-yl)propanedioate |
| SMILES | CCOC(=O)C1=C(C(C(=O)OCC)C(=O)OCC)CCN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C22H27NO7/c1-4-28-20(25)17-16(18(21(26)29-5-2)22(27)30-6-3)12-13-23(19(17)24)14-15-10-8-7-9-11-15/h7-11,18H,4-6,12-14H2,1-3H3 |
| InChIKey | DYSHCVCRYXOSCV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|