C24H33NO7 — CID 177444052
(7E,9R,10S,15R,16S)-9,15-dihydroxy-4,10,16-trimethyl-11-(2-phenylethyl)-1,5-dioxa-11-azacyclohexadec-7-ene-2,6,12-trione (PubChem CID 177444052) has the molecular formula C24H33NO7 and a molecular weight of 447.53 g/mol. Its IUPAC name is (7E,9R,10S,15R,16S)-9,15-dihydroxy-4,10,16-trimethyl-11-(2-phenylethyl)-1,5-dioxa-11-azacyclohexadec-7-ene-2,6,12-trione.
| Compound Name | (7E,9R,10S,15R,16S)-9,15-dihydroxy-4,10,16-trimethyl-11-(2-phenylethyl)-1,5-dioxa-11-azacyclohexadec-7-ene-2,6,12-trione |
|---|---|
| PubChem CID | 177444052 |
| Molecular Formula | C24H33NO7 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | (7E,9R,10S,15R,16S)-9,15-dihydroxy-4,10,16-trimethyl-11-(2-phenylethyl)-1,5-dioxa-11-azacyclohexadec-7-ene-2,6,12-trione |
| SMILES | CC1CC(=O)O[C@@H](C)[C@H](O)CCC(=O)N(CCc2ccccc2)[C@@H](C)[C@H](O)/C=C/C(=O)O1 |
| InChI | InChI=1S/C24H33NO7/c1-16-15-24(30)32-18(3)21(27)9-11-22(28)25(14-13-19-7-5-4-6-8-19)17(2)20(26)10-12-23(29)31-16/h4-8,10,12,16-18,20-21,26-27H,9,11,13-15H2,1-3H3/b12-10+/t16?,17-,18-,20+,21+/m0/s1 |
| InChIKey | ZJPZNASUQVZRHE-VKDVOLETSA-N |
| XLogP | 1.77 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |