C12H12O3S — CID 139192472
(1S,2S)-3-[(R)-phenylsulfinyl]cyclohexa-3,5-diene-1,2-diol (PubChem CID 139192472) has the molecular formula C12H12O3S and a molecular weight of 236.29 g/mol. Its IUPAC name is (1S,2S)-3-[(R)-phenylsulfinyl]cyclohexa-3,5-diene-1,2-diol.
| Compound Name | (1S,2S)-3-[(R)-phenylsulfinyl]cyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 139192472 |
| Molecular Formula | C12H12O3S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | (1S,2S)-3-[(R)-phenylsulfinyl]cyclohexa-3,5-diene-1,2-diol |
| SMILES | O=[S@@](C1=CC=C[C@H](O)[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C12H12O3S/c13-10-7-4-8-11(12(10)14)16(15)9-5-2-1-3-6-9/h1-8,10,12-14H/t10-,12-,16+/m0/s1 |
| InChIKey | MGFLFCRASXYEMA-KNHMANMVSA-N |
| XLogP | 0.97 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |