C13H16N4O2S — CID 174862633
benzenesulfinylbenzene;1,1-diaminourea (PubChem CID 174862633) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is benzenesulfinylbenzene;1,1-diaminourea.
| Compound Name | benzenesulfinylbenzene;1,1-diaminourea |
|---|---|
| PubChem CID | 174862633 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | benzenesulfinylbenzene;1,1-diaminourea |
| SMILES | NC(=O)N(N)N.O=S(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10OS.CH6N4O/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;2-1(6)5(3)4/h1-10H;3-4H2,(H2,2,6) |
| InChIKey | ABZSUXJHALDXTF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|