About 3-(benzenesulfinyl)benzamide;pyrrolidine
3-(benzenesulfinyl)benzamide;pyrrolidine (PubChem CID 143667202) has the molecular formula C17H20N2O2S
and a molecular weight of 316.43 g/mol. Its IUPAC name is 3-(benzenesulfinyl)benzamide;pyrrolidine.
Molecular Properties
| Compound Name | 3-(benzenesulfinyl)benzamide;pyrrolidine |
| PubChem CID | 143667202 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 3-(benzenesulfinyl)benzamide;pyrrolidine |
| SMILES | C1CCNC1.NC(=O)c1cccc(S(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C13H11NO2S.C4H9N/c14-13(15)10-5-4-8-12(9-10)17(16)11-6-2-1-3-7-11;1-2-4-5-3-1/h1-9H,(H2,14,15);5H,1-4H2 |
| InChIKey | KNXJYTPXZDZTIU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(benzenesulfinyl)benzamide;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfinyl)benzamide;pyrrolidine?
The IUPAC name of 3-(benzenesulfinyl)benzamide;pyrrolidine (CID 143667202) is 3-(benzenesulfinyl)benzamide;pyrrolidine.
What is the SMILES notation for 3-(benzenesulfinyl)benzamide;pyrrolidine?
The canonical SMILES for 3-(benzenesulfinyl)benzamide;pyrrolidine is C1CCNC1.NC(=O)c1cccc(S(=O)c2ccccc2)c1.
What is the InChIKey of 3-(benzenesulfinyl)benzamide;pyrrolidine?
The InChIKey is KNXJYTPXZDZTIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO2S.C4H9N/c14-13(15)10-5-4-8-12(9-10)17(16)11-6-2-1-3-7-11;1-2-4-5-3-1/h1-9H,(H2,14,15);5H,1-4H2.
What are the key properties of 3-(benzenesulfinyl)benzamide;pyrrolidine?
3-(benzenesulfinyl)benzamide;pyrrolidine has a molecular weight of 316.43 g/mol, XLogP of 2.32, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfinyl)benzamide;pyrrolidine is sourced from PubChem (CID 143667202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).