About benzenesulfinylurea
benzenesulfinylurea (PubChem CID 18678947) has the molecular formula C7H8N2O2S
and a molecular weight of 184.22 g/mol. Its IUPAC name is benzenesulfinylurea.
Molecular Properties
| Compound Name | benzenesulfinylurea |
| PubChem CID | 18678947 |
| Molecular Formula | C7H8N2O2S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | benzenesulfinylurea |
| SMILES | NC(=O)NS(=O)c1ccccc1 |
| InChI | InChI=1S/C7H8N2O2S/c8-7(10)9-12(11)6-4-2-1-3-5-6/h1-5H,(H3,8,9,10) |
| InChIKey | NNHSFBDNDJBVBD-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzenesulfinylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfinylurea?
The IUPAC name of benzenesulfinylurea (CID 18678947) is benzenesulfinylurea.
What is the SMILES notation for benzenesulfinylurea?
The canonical SMILES for benzenesulfinylurea is NC(=O)NS(=O)c1ccccc1.
What is the InChIKey of benzenesulfinylurea?
The InChIKey is NNHSFBDNDJBVBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2S/c8-7(10)9-12(11)6-4-2-1-3-5-6/h1-5H,(H3,8,9,10).
What are the key properties of benzenesulfinylurea?
benzenesulfinylurea has a molecular weight of 184.22 g/mol, XLogP of 0.38, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfinylurea is sourced from PubChem (CID 18678947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).