C9H9FO — CID 151740601
2-fluoro-2,3,3a,4-tetrahydroinden-1-one (PubChem CID 151740601) has the molecular formula C9H9FO and a molecular weight of 152.17 g/mol. Its IUPAC name is 2-fluoro-2,3,3a,4-tetrahydroinden-1-one.
| Compound Name | 2-fluoro-2,3,3a,4-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 151740601 |
| Molecular Formula | C9H9FO |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 2-fluoro-2,3,3a,4-tetrahydroinden-1-one |
| SMILES | O=C1C2=CC=CCC2CC1F |
| InChI | InChI=1S/C9H9FO/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-2,4,6,8H,3,5H2 |
| InChIKey | RMLDXSYBSZRECO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |