C9H13NO2 — CID 156773047
3,4,4a,5-tetrahydro-2H-isoquinolin-1-one;hydrate (PubChem CID 156773047) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 3,4,4a,5-tetrahydro-2H-isoquinolin-1-one;hydrate.
| Compound Name | 3,4,4a,5-tetrahydro-2H-isoquinolin-1-one;hydrate |
|---|---|
| PubChem CID | 156773047 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 3,4,4a,5-tetrahydro-2H-isoquinolin-1-one;hydrate |
| SMILES | O.O=C1NCCC2CC=CC=C12 |
| InChI | InChI=1S/C9H11NO.H2O/c11-9-8-4-2-1-3-7(8)5-6-10-9;/h1-2,4,7H,3,5-6H2,(H,10,11);1H2 |
| InChIKey | NFHBCKZFBOYDRY-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |