C10H12 — CID 90996575
3-methyl-7,7a-dihydro-1H-indene (PubChem CID 90996575) has the molecular formula C10H12 and a molecular weight of 132.21 g/mol. Its IUPAC name is 3-methyl-7,7a-dihydro-1H-indene.
| Compound Name | 3-methyl-7,7a-dihydro-1H-indene |
|---|---|
| PubChem CID | 90996575 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 3-methyl-7,7a-dihydro-1H-indene |
| SMILES | CC1=CCC2CC=CC=C12 |
| InChI | InChI=1S/C10H12/c1-8-6-7-9-4-2-3-5-10(8)9/h2-3,5-6,9H,4,7H2,1H3 |
| InChIKey | YUGIKXDQXQGGGX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |