C16H17N — CID 56995744
tricyclo[10.4.0.04,9]hexadeca-1(16),6,8,10,14-pentaen-2-imine (PubChem CID 56995744) has the molecular formula C16H17N and a molecular weight of 223.32 g/mol. Its IUPAC name is tricyclo[10.4.0.04,9]hexadeca-1(16),6,8,10,14-pentaen-2-imine.
| Compound Name | tricyclo[10.4.0.04,9]hexadeca-1(16),6,8,10,14-pentaen-2-imine |
|---|---|
| PubChem CID | 56995744 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | tricyclo[10.4.0.04,9]hexadeca-1(16),6,8,10,14-pentaen-2-imine |
| SMILES | [H]/N=C1\CC2CC=CC=C2C=CC2CC=CC=C12 |
| InChI | InChI=1S/C16H17N/c17-16-11-14-7-2-1-5-12(14)9-10-13-6-3-4-8-15(13)16/h1-5,8-10,13-14,17H,6-7,11H2/b10-9?,17-16+ |
| InChIKey | NGUAHVRZEOHMQA-WREUFWCNSA-N |
| XLogP | 3.97 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|