C10H10S — CID 163854702
8,8a-dihydronaphthalene-2-thiol (PubChem CID 163854702) has the molecular formula C10H10S and a molecular weight of 162.26 g/mol. Its IUPAC name is 8,8a-dihydronaphthalene-2-thiol.
| Compound Name | 8,8a-dihydronaphthalene-2-thiol |
|---|---|
| PubChem CID | 163854702 |
| Molecular Formula | C10H10S |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 8,8a-dihydronaphthalene-2-thiol |
| SMILES | SC1=CC2CC=CC=C2C=C1 |
| InChI | InChI=1S/C10H10S/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-3,5-7,9,11H,4H2 |
| InChIKey | OXIMLFMMWSMQSD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|