C14H16 — CID 173432226
1,2,3,4,5,10a-hexahydroanthracene (PubChem CID 173432226) has the molecular formula C14H16 and a molecular weight of 184.28 g/mol. Its IUPAC name is 1,2,3,4,5,10a-hexahydroanthracene.
| Compound Name | 1,2,3,4,5,10a-hexahydroanthracene |
|---|---|
| PubChem CID | 173432226 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 1,2,3,4,5,10a-hexahydroanthracene |
| SMILES | C1=CCC2C=C3CCCCC3=CC2=C1 |
| InChI | InChI=1S/C14H16/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-2,5,9-10,12H,3-4,6-8H2 |
| InChIKey | OPLVUVRUYMKKPJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |