C15H18OS — CID 123442025
3-[3-(methoxymethyl)-4a,5-dihydronaphthalen-2-yl]prop-2-ene-1-thiol (PubChem CID 123442025) has the molecular formula C15H18OS and a molecular weight of 246.38 g/mol. Its IUPAC name is 3-[3-(methoxymethyl)-4a,5-dihydronaphthalen-2-yl]prop-2-ene-1-thiol.
| Compound Name | 3-[3-(methoxymethyl)-4a,5-dihydronaphthalen-2-yl]prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 123442025 |
| Molecular Formula | C15H18OS |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 3-[3-(methoxymethyl)-4a,5-dihydronaphthalen-2-yl]prop-2-ene-1-thiol |
| SMILES | COCC1=CC2CC=CC=C2C=C1C=CCS |
| InChI | InChI=1S/C15H18OS/c1-16-11-15-10-13-6-3-2-5-12(13)9-14(15)7-4-8-17/h2-5,7,9-10,13,17H,6,8,11H2,1H3 |
| InChIKey | WBRRYFCTHJLVMB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|