About 6-methoxycyclohexa-1,3-dien-1-amine
6-methoxycyclohexa-1,3-dien-1-amine (PubChem CID 89029184) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is 6-methoxycyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 6-methoxycyclohexa-1,3-dien-1-amine |
| PubChem CID | 89029184 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 6-methoxycyclohexa-1,3-dien-1-amine |
| SMILES | COC1CC=CC=C1N |
| InChI | InChI=1S/C7H11NO/c1-9-7-5-3-2-4-6(7)8/h2-4,7H,5,8H2,1H3 |
| InChIKey | SGTAGOKZGNYTOR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methoxycyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxycyclohexa-1,3-dien-1-amine?
The IUPAC name of 6-methoxycyclohexa-1,3-dien-1-amine (CID 89029184) is 6-methoxycyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 6-methoxycyclohexa-1,3-dien-1-amine?
The canonical SMILES for 6-methoxycyclohexa-1,3-dien-1-amine is COC1CC=CC=C1N.
What is the InChIKey of 6-methoxycyclohexa-1,3-dien-1-amine?
The InChIKey is SGTAGOKZGNYTOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO/c1-9-7-5-3-2-4-6(7)8/h2-4,7H,5,8H2,1H3.
What are the key properties of 6-methoxycyclohexa-1,3-dien-1-amine?
6-methoxycyclohexa-1,3-dien-1-amine has a molecular weight of 125.17 g/mol, XLogP of 0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxycyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 89029184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).