C16H24 — CID 142864033
ethane;ethene;7-ethyl-1,8a-dihydronaphthalene (PubChem CID 142864033) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is ethane;ethene;7-ethyl-1,8a-dihydronaphthalene.
| Compound Name | ethane;ethene;7-ethyl-1,8a-dihydronaphthalene |
|---|---|
| PubChem CID | 142864033 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | ethane;ethene;7-ethyl-1,8a-dihydronaphthalene |
| SMILES | C=C.CC.CCC1=CC2CC=CC=C2C=C1 |
| InChI | InChI=1S/C12H14.C2H6.C2H4/c1-2-10-7-8-11-5-3-4-6-12(11)9-10;2*1-2/h3-5,7-9,12H,2,6H2,1H3;1-2H3;1-2H2 |
| InChIKey | LZWQBWKVOLLCIG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|