C10H10O — CID 148551403
8,8a-dihydronaphthalen-1-ol (PubChem CID 148551403) has the molecular formula C10H10O and a molecular weight of 146.19 g/mol. Its IUPAC name is 8,8a-dihydronaphthalen-1-ol.
| Compound Name | 8,8a-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 148551403 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 8,8a-dihydronaphthalen-1-ol |
| SMILES | OC1=CC=CC2=CC=CCC12 |
| InChI | InChI=1S/C10H10O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-5,7,9,11H,6H2 |
| InChIKey | MTFMWDVUBLIGSE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |